C5H5F2NO — CID 143412253
1-(2,2-difluoroethenyl)azetidin-2-one (PubChem CID 143412253) has the molecular formula C5H5F2NO and a molecular weight of 133.10 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)azetidin-2-one.
| Compound Name | 1-(2,2-difluoroethenyl)azetidin-2-one |
|---|---|
| PubChem CID | 143412253 |
| Molecular Formula | C5H5F2NO |
| Molecular Weight | 133.10 g/mol |
| Exact Mass | 133.03 |
| IUPAC Name | 1-(2,2-difluoroethenyl)azetidin-2-one |
| SMILES | O=C1CCN1C=C(F)F |
| InChI | InChI=1S/C5H5F2NO/c6-4(7)3-8-2-1-5(8)9/h3H,1-2H2 |
| InChIKey | RCUPKGHWEAPETF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.10 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |