C10H12N2O5 — CID 139993356
2-[2,6-dioxo-5-(2-oxoethenyl)-1,5-diazocan-1-yl]acetic acid (PubChem CID 139993356) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 2-[2,6-dioxo-5-(2-oxoethenyl)-1,5-diazocan-1-yl]acetic acid.
| Compound Name | 2-[2,6-dioxo-5-(2-oxoethenyl)-1,5-diazocan-1-yl]acetic acid |
|---|---|
| PubChem CID | 139993356 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-[2,6-dioxo-5-(2-oxoethenyl)-1,5-diazocan-1-yl]acetic acid |
| SMILES | O=C=CN1CCC(=O)N(CC(=O)O)CCC1=O |
| InChI | InChI=1S/C10H12N2O5/c13-6-5-11-3-1-9(15)12(7-10(16)17)4-2-8(11)14/h5H,1-4,7H2,(H,16,17) |
| InChIKey | ZDPXPFFYFVUPJF-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|