C12H13NO3 — CID 70231632
2-(3-oxo-4,5-dihydro-1H-2-benzazepin-2-yl)acetic acid (PubChem CID 70231632) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-(3-oxo-4,5-dihydro-1H-2-benzazepin-2-yl)acetic acid.
| Compound Name | 2-(3-oxo-4,5-dihydro-1H-2-benzazepin-2-yl)acetic acid |
|---|---|
| PubChem CID | 70231632 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-(3-oxo-4,5-dihydro-1H-2-benzazepin-2-yl)acetic acid |
| SMILES | O=C(O)CN1Cc2ccccc2CCC1=O |
| InChI | InChI=1S/C12H13NO3/c14-11-6-5-9-3-1-2-4-10(9)7-13(11)8-12(15)16/h1-4H,5-8H2,(H,15,16) |
| InChIKey | BUDWPGSSYJHKJX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |