About 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one
2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one (PubChem CID 162631433) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one.
Molecular Properties
| Compound Name | 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one |
| PubChem CID | 162631433 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one |
| SMILES | CCOCCN1Cc2ccccc2CCC1=O |
| InChI | InChI=1S/C14H19NO2/c1-2-17-10-9-15-11-13-6-4-3-5-12(13)7-8-14(15)16/h3-6H,2,7-11H2,1H3 |
| InChIKey | OCMCTSNSVKOEEO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one?
The IUPAC name of 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one (CID 162631433) is 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one.
What is the SMILES notation for 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one?
The canonical SMILES for 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one is CCOCCN1Cc2ccccc2CCC1=O.
What is the InChIKey of 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one?
The InChIKey is OCMCTSNSVKOEEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-2-17-10-9-15-11-13-6-4-3-5-12(13)7-8-14(15)16/h3-6H,2,7-11H2,1H3.
What are the key properties of 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one?
2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one has a molecular weight of 233.31 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxyethyl)-4,5-dihydro-1H-2-benzazepin-3-one is sourced from PubChem (CID 162631433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).