About 1-silylazetidin-2-one
1-silylazetidin-2-one (PubChem CID 71361238) has the molecular formula C3H7NOSi
and a molecular weight of 101.18 g/mol. Its IUPAC name is 1-silylazetidin-2-one.
Molecular Properties
| Compound Name | 1-silylazetidin-2-one |
| PubChem CID | 71361238 |
| Molecular Formula | C3H7NOSi |
| Molecular Weight | 101.18 g/mol |
| Exact Mass | 101.03 |
| IUPAC Name | 1-silylazetidin-2-one |
| SMILES | O=C1CCN1[SiH3] |
| InChI | InChI=1S/C3H7NOSi/c5-3-1-2-4(3)6/h1-2H2,6H3 |
| InChIKey | LDPZKDYZCJRNLC-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.18 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-silylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-silylazetidin-2-one?
The IUPAC name of 1-silylazetidin-2-one (CID 71361238) is 1-silylazetidin-2-one.
What is the SMILES notation for 1-silylazetidin-2-one?
The canonical SMILES for 1-silylazetidin-2-one is O=C1CCN1[SiH3].
What is the InChIKey of 1-silylazetidin-2-one?
The InChIKey is LDPZKDYZCJRNLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NOSi/c5-3-1-2-4(3)6/h1-2H2,6H3.
What are the key properties of 1-silylazetidin-2-one?
1-silylazetidin-2-one has a molecular weight of 101.18 g/mol, XLogP of -1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-silylazetidin-2-one is sourced from PubChem (CID 71361238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).