2-oxoazetidine-1-sulfinyl chloride

C3H4ClNO2S — CID 20569487

IUPAC2-oxoazetidine-1-sulfinyl chloride
SMILESO=C1CCN1S(=O)Cl
InChIInChI=1S/C3H4ClNO2S/c4-8(7)5-2-1-3(5)6/h1-2H2
InChIKeyHEWUUUAOFGCFHK-UHFFFAOYSA-N
MW153.59 g/mol
LogP0.04
Rot. Bonds1

About 2-oxoazetidine-1-sulfinyl chloride

2-oxoazetidine-1-sulfinyl chloride (PubChem CID 20569487) has the molecular formula C3H4ClNO2S and a molecular weight of 153.59 g/mol. Its IUPAC name is 2-oxoazetidine-1-sulfinyl chloride.

Molecular Properties

Compound Name2-oxoazetidine-1-sulfinyl chloride
PubChem CID20569487
Molecular FormulaC3H4ClNO2S
Molecular Weight153.59 g/mol
Exact Mass152.97
IUPAC Name2-oxoazetidine-1-sulfinyl chloride
SMILESO=C1CCN1S(=O)Cl
InChIInChI=1S/C3H4ClNO2S/c4-8(7)5-2-1-3(5)6/h1-2H2
InChIKeyHEWUUUAOFGCFHK-UHFFFAOYSA-N
XLogP0.04
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.59
LogP ≤ 50.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-oxoazetidine-1-sulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxoazetidine-1-sulfinyl chloride?
The IUPAC name of 2-oxoazetidine-1-sulfinyl chloride (CID 20569487) is 2-oxoazetidine-1-sulfinyl chloride.
What is the SMILES notation for 2-oxoazetidine-1-sulfinyl chloride?
The canonical SMILES for 2-oxoazetidine-1-sulfinyl chloride is O=C1CCN1S(=O)Cl.
What is the InChIKey of 2-oxoazetidine-1-sulfinyl chloride?
The InChIKey is HEWUUUAOFGCFHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4ClNO2S/c4-8(7)5-2-1-3(5)6/h1-2H2.
What are the key properties of 2-oxoazetidine-1-sulfinyl chloride?
2-oxoazetidine-1-sulfinyl chloride has a molecular weight of 153.59 g/mol, XLogP of 0.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoazetidine-1-sulfinyl chloride is sourced from PubChem (CID 20569487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).