C4H5INNaO5S — CID 175003776
sodium;hydrogen sulfite;1-iodopyrrolidine-2,5-dione (PubChem CID 175003776) has the molecular formula C4H5INNaO5S and a molecular weight of 329.05 g/mol. Its IUPAC name is sodium;hydrogen sulfite;1-iodopyrrolidine-2,5-dione.
| Compound Name | sodium;hydrogen sulfite;1-iodopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175003776 |
| Molecular Formula | C4H5INNaO5S |
| Molecular Weight | 329.05 g/mol |
| Exact Mass | 328.88 |
| IUPAC Name | sodium;hydrogen sulfite;1-iodopyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1I.O=S([O-])O.[Na+] |
| InChI | InChI=1S/C4H4INO2.Na.H2O3S/c5-6-3(7)1-2-4(6)8;;1-4(2)3/h1-2H2;;(H2,1,2,3)/q;+1;/p-1 |
| InChIKey | GWUYVGFAVRWTJS-UHFFFAOYSA-M |
| XLogP | -3.17 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.05 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|