C12H12BrNO — CID 56964850
1-[(Z)-2-(2-bromophenyl)ethenyl]pyrrolidin-2-one (PubChem CID 56964850) has the molecular formula C12H12BrNO and a molecular weight of 266.14 g/mol. Its IUPAC name is 1-[(Z)-2-(2-bromophenyl)ethenyl]pyrrolidin-2-one.
| Compound Name | 1-[(Z)-2-(2-bromophenyl)ethenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 56964850 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 1-[(Z)-2-(2-bromophenyl)ethenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1/C=C\c1ccccc1Br |
| InChI | InChI=1S/C12H12BrNO/c13-11-5-2-1-4-10(11)7-9-14-8-3-6-12(14)15/h1-2,4-5,7,9H,3,6,8H2/b9-7- |
| InChIKey | HDCRDZNHCKZFGM-CLFYSBASSA-N |
| XLogP | 3.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |