C19H16BrNO2 — CID 8646864
1-[4-[(E)-3-(2-bromophenyl)prop-2-enoyl]phenyl]pyrrolidin-2-one (PubChem CID 8646864) has the molecular formula C19H16BrNO2 and a molecular weight of 370.25 g/mol. Its IUPAC name is 1-[4-[(E)-3-(2-bromophenyl)prop-2-enoyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(E)-3-(2-bromophenyl)prop-2-enoyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 8646864 |
| Molecular Formula | C19H16BrNO2 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 1-[4-[(E)-3-(2-bromophenyl)prop-2-enoyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C(/C=C/c1ccccc1Br)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H16BrNO2/c20-17-5-2-1-4-14(17)9-12-18(22)15-7-10-16(11-8-15)21-13-3-6-19(21)23/h1-2,4-5,7-12H,3,6,13H2/b12-9+ |
| InChIKey | MRSWTDKKJPRKRC-FMIVXFBMSA-N |
| XLogP | 4.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|