C20H18BrNO4 — CID 7571779
1-[4-[(E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-2-one (PubChem CID 7571779) has the molecular formula C20H18BrNO4 and a molecular weight of 416.27 g/mol. Its IUPAC name is 1-[4-[(E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 7571779 |
| Molecular Formula | C20H18BrNO4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1-[4-[(E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enoyl]phenyl]pyrrolidin-2-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(N3CCCC3=O)cc2)cc(Br)c1O |
| InChI | InChI=1S/C20H18BrNO4/c1-26-18-12-13(11-16(21)20(18)25)4-9-17(23)14-5-7-15(8-6-14)22-10-2-3-19(22)24/h4-9,11-12,25H,2-3,10H2,1H3/b9-4+ |
| InChIKey | JOFIPMISTKARHU-RUDMXATFSA-N |
| XLogP | 4.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|