C16H20BrN3O2 — CID 108904928
1-[(E)-2-(2-bromophenyl)ethenyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea (PubChem CID 108904928) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 1-[(E)-2-(2-bromophenyl)ethenyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea.
| Compound Name | 1-[(E)-2-(2-bromophenyl)ethenyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 108904928 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-[(E)-2-(2-bromophenyl)ethenyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
| SMILES | O=C(N/C=C/c1ccccc1Br)NCCCN1CCCC1=O |
| InChI | InChI=1S/C16H20BrN3O2/c17-14-6-2-1-5-13(14)8-10-19-16(22)18-9-4-12-20-11-3-7-15(20)21/h1-2,5-6,8,10H,3-4,7,9,11-12H2,(H2,18,19,22)/b10-8+ |
| InChIKey | QTYIYXZUDCTCCO-CSKARUKUSA-N |
| XLogP | 2.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|