C17H23N3O3 — CID 108907537
1-[(E)-2-(4-methoxyphenyl)ethenyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea (PubChem CID 108907537) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[(E)-2-(4-methoxyphenyl)ethenyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea.
| Compound Name | 1-[(E)-2-(4-methoxyphenyl)ethenyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 108907537 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[(E)-2-(4-methoxyphenyl)ethenyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
| SMILES | COc1ccc(/C=C/NC(=O)NCCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-23-15-7-5-14(6-8-15)9-11-19-17(22)18-10-3-13-20-12-2-4-16(20)21/h5-9,11H,2-4,10,12-13H2,1H3,(H2,18,19,22)/b11-9+ |
| InChIKey | DTPJIFSOTZXGCJ-PKNBQFBNSA-N |
| XLogP | 1.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|