C19H26N4O4 — CID 7544280
1-[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea (PubChem CID 7544280) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea.
| Compound Name | 1-[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 7544280 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]urea |
| SMILES | COc1cccc(N2C[C@@H](NC(=O)NCCCN3CCCC3=O)CC2=O)c1 |
| InChI | InChI=1S/C19H26N4O4/c1-27-16-6-2-5-15(12-16)23-13-14(11-18(23)25)21-19(26)20-8-4-10-22-9-3-7-17(22)24/h2,5-6,12,14H,3-4,7-11,13H2,1H3,(H2,20,21,26)/t14-/m0/s1 |
| InChIKey | XMXSXQNKCXRCSP-AWEZNQCLSA-N |
| XLogP | 1.11 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|