C17H25N5O3 — CID 43969825
1-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(4-methylpiperazin-1-yl)urea (PubChem CID 43969825) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(4-methylpiperazin-1-yl)urea.
| Compound Name | 1-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(4-methylpiperazin-1-yl)urea |
|---|---|
| PubChem CID | 43969825 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(4-methylpiperazin-1-yl)urea |
| SMILES | COc1cccc(N2CC(NC(=O)NN3CCN(C)CC3)CC2=O)c1 |
| InChI | InChI=1S/C17H25N5O3/c1-20-6-8-21(9-7-20)19-17(24)18-13-10-16(23)22(12-13)14-4-3-5-15(11-14)25-2/h3-5,11,13H,6-10,12H2,1-2H3,(H2,18,19,24) |
| InChIKey | DTUVSUQAENXBGV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |