C16H22ClN5O2 — CID 7552068
1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(4-methylpiperazin-1-yl)urea (PubChem CID 7552068) has the molecular formula C16H22ClN5O2 and a molecular weight of 351.84 g/mol. Its IUPAC name is 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(4-methylpiperazin-1-yl)urea.
| Compound Name | 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(4-methylpiperazin-1-yl)urea |
|---|---|
| PubChem CID | 7552068 |
| Molecular Formula | C16H22ClN5O2 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(4-methylpiperazin-1-yl)urea |
| SMILES | CN1CCN(NC(=O)N[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C16H22ClN5O2/c1-20-6-8-21(9-7-20)19-16(24)18-13-10-15(23)22(11-13)14-4-2-12(17)3-5-14/h2-5,13H,6-11H2,1H3,(H2,18,19,24)/t13-/m0/s1 |
| InChIKey | MPWLLFLPDGFTTR-ZDUSSCGKSA-N |
| XLogP | 0.91 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |