C13H16ClN3O3 — CID 7548798
1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2-hydroxyethyl)urea (PubChem CID 7548798) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 7548798 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-[(3S)-1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)N[C@H]1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C13H16ClN3O3/c14-9-1-3-11(4-2-9)17-8-10(7-12(17)19)16-13(20)15-5-6-18/h1-4,10,18H,5-8H2,(H2,15,16,20)/t10-/m0/s1 |
| InChIKey | IVVIZBXQWNWWBO-JTQLQIEISA-N |
| XLogP | 0.74 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |