C17H24ClN3O4 — CID 43970438
1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2,2-diethoxyethyl)urea (PubChem CID 43970438) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2,2-diethoxyethyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2,2-diethoxyethyl)urea |
|---|---|
| PubChem CID | 43970438 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(2,2-diethoxyethyl)urea |
| SMILES | CCOC(CNC(=O)NC1CC(=O)N(c2ccc(Cl)cc2)C1)OCC |
| InChI | InChI=1S/C17H24ClN3O4/c1-3-24-16(25-4-2)10-19-17(23)20-13-9-15(22)21(11-13)14-7-5-12(18)6-8-14/h5-8,13,16H,3-4,9-11H2,1-2H3,(H2,19,20,23) |
| InChIKey | VVJHCPKLYWPPAR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|