C19H29N3O4 — CID 7543184
1-(2,2-diethoxyethyl)-3-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 7543184) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(2,2-diethoxyethyl)-3-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 7543184 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | CCOC(CNC(=O)N[C@H]1CC(=O)N(c2ccc(C)c(C)c2)C1)OCC |
| InChI | InChI=1S/C19H29N3O4/c1-5-25-18(26-6-2)11-20-19(24)21-15-10-17(23)22(12-15)16-8-7-13(3)14(4)9-16/h7-9,15,18H,5-6,10-12H2,1-4H3,(H2,20,21,24)/t15-/m0/s1 |
| InChIKey | OHJINIDGUGEYMH-HNNXBMFYSA-N |
| XLogP | 2.11 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|