C18H27N3O2 — CID 7543385
1-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-pentylurea (PubChem CID 7543385) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-pentylurea.
| Compound Name | 1-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-pentylurea |
|---|---|
| PubChem CID | 7543385 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-pentylurea |
| SMILES | CCCCCNC(=O)N[C@H]1CC(=O)N(c2ccc(C)c(C)c2)C1 |
| InChI | InChI=1S/C18H27N3O2/c1-4-5-6-9-19-18(23)20-15-11-17(22)21(12-15)16-8-7-13(2)14(3)10-16/h7-8,10,15H,4-6,9,11-12H2,1-3H3,(H2,19,20,23)/t15-/m0/s1 |
| InChIKey | PEFQIGJLIQBZCN-HNNXBMFYSA-N |
| XLogP | 2.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|