C22H37N5O2+2 — CID 7543761
1-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(4-ethylpiperazine-1,4-diium-1-yl)propyl]urea (PubChem CID 7543761) has the molecular formula C22H37N5O2+2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(4-ethylpiperazine-1,4-diium-1-yl)propyl]urea.
| Compound Name | 1-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(4-ethylpiperazine-1,4-diium-1-yl)propyl]urea |
|---|---|
| PubChem CID | 7543761 |
| Molecular Formula | C22H37N5O2+2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 1-[(3S)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(4-ethylpiperazine-1,4-diium-1-yl)propyl]urea |
| SMILES | CC[NH+]1CC[NH+](CCCNC(=O)N[C@H]2CC(=O)N(c3ccc(C)c(C)c3)C2)CC1 |
| InChI | InChI=1S/C22H35N5O2/c1-4-25-10-12-26(13-11-25)9-5-8-23-22(29)24-19-15-21(28)27(16-19)20-7-6-17(2)18(3)14-20/h6-7,14,19H,4-5,8-13,15-16H2,1-3H3,(H2,23,24,29)/p+2/t19-/m0/s1 |
| InChIKey | TZSSFECBOASOTN-IBGZPJMESA-P |
| XLogP | -1.10 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|