C21H33N4O4+ — CID 7244481
1-[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(3-piperidin-1-ium-1-ylpropyl)urea (PubChem CID 7244481) has the molecular formula C21H33N4O4+ and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(3-piperidin-1-ium-1-ylpropyl)urea.
| Compound Name | 1-[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(3-piperidin-1-ium-1-ylpropyl)urea |
|---|---|
| PubChem CID | 7244481 |
| Molecular Formula | C21H33N4O4+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 1-[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-(3-piperidin-1-ium-1-ylpropyl)urea |
| SMILES | COc1ccc(N2C[C@H](NC(=O)NCCC[NH+]3CCCCC3)CC2=O)cc1OC |
| InChI | InChI=1S/C21H32N4O4/c1-28-18-8-7-17(14-19(18)29-2)25-15-16(13-20(25)26)23-21(27)22-9-6-12-24-10-4-3-5-11-24/h7-8,14,16H,3-6,9-13,15H2,1-2H3,(H2,22,23,27)/p+1/t16-/m1/s1 |
| InChIKey | IFMQGQWKJWOTQZ-MRXNPFEDSA-O |
| XLogP | 0.57 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|