C20H30FN4O2+ — CID 7548436
1-[3-(azepan-1-ium-1-yl)propyl]-3-[(3S)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 7548436) has the molecular formula C20H30FN4O2+ and a molecular weight of 377.48 g/mol. Its IUPAC name is 1-[3-(azepan-1-ium-1-yl)propyl]-3-[(3S)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-[3-(azepan-1-ium-1-yl)propyl]-3-[(3S)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 7548436 |
| Molecular Formula | C20H30FN4O2+ |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 1-[3-(azepan-1-ium-1-yl)propyl]-3-[(3S)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | O=C(NCCC[NH+]1CCCCCC1)N[C@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H29FN4O2/c21-16-6-8-18(9-7-16)25-15-17(14-19(25)26)23-20(27)22-10-5-13-24-11-3-1-2-4-12-24/h6-9,17H,1-5,10-15H2,(H2,22,23,27)/p+1/t17-/m0/s1 |
| InChIKey | AOASVFHKPUQACA-KRWDZBQOSA-O |
| XLogP | 1.08 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|