C15H21N3O4 — CID 43970655
1-[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-ethylurea (PubChem CID 43970655) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-ethylurea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-ethylurea |
|---|---|
| PubChem CID | 43970655 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-ethylurea |
| SMILES | CCNC(=O)NC1CC(=O)N(c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C15H21N3O4/c1-4-16-15(20)17-10-7-14(19)18(9-10)11-5-6-12(21-2)13(8-11)22-3/h5-6,8,10H,4,7,9H2,1-3H3,(H2,16,17,20) |
| InChIKey | JBOFWZRAJKCMKK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |