C22H35N5O4 — CID 7552579
1-[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(4-ethylpiperazin-1-yl)propyl]urea (PubChem CID 7552579) has the molecular formula C22H35N5O4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(4-ethylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(4-ethylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 7552579 |
| Molecular Formula | C22H35N5O4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 1-[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(4-ethylpiperazin-1-yl)propyl]urea |
| SMILES | CCN1CCN(CCCNC(=O)N[C@@H]2CC(=O)N(c3ccc(OC)c(OC)c3)C2)CC1 |
| InChI | InChI=1S/C22H35N5O4/c1-4-25-10-12-26(13-11-25)9-5-8-23-22(29)24-17-14-21(28)27(16-17)18-6-7-19(30-2)20(15-18)31-3/h6-7,15,17H,4-5,8-14,16H2,1-3H3,(H2,23,24,29)/t17-/m1/s1 |
| InChIKey | YMAJOLNUNDEGNV-QGZVFWFLSA-N |
| XLogP | 1.14 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|