C22H37N4O4+ — CID 7552586
3-[[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]propyl-dipropylazanium (PubChem CID 7552586) has the molecular formula C22H37N4O4+ and a molecular weight of 421.56 g/mol. Its IUPAC name is 3-[[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]propyl-dipropylazanium.
| Compound Name | 3-[[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]propyl-dipropylazanium |
|---|---|
| PubChem CID | 7552586 |
| Molecular Formula | C22H37N4O4+ |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 3-[[(3R)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]propyl-dipropylazanium |
| SMILES | CCC[NH+](CCC)CCCNC(=O)N[C@@H]1CC(=O)N(c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C22H36N4O4/c1-5-11-25(12-6-2)13-7-10-23-22(28)24-17-14-21(27)26(16-17)18-8-9-19(29-3)20(15-18)30-4/h8-9,15,17H,5-7,10-14,16H2,1-4H3,(H2,23,24,28)/p+1/t17-/m1/s1 |
| InChIKey | KLCFIYZFOAHVBN-QGZVFWFLSA-O |
| XLogP | 1.20 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|