C22H35N4O4+ — CID 7552335
3-[[(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]carbamoylamino]propyl-dipropylazanium (PubChem CID 7552335) has the molecular formula C22H35N4O4+ and a molecular weight of 419.55 g/mol. Its IUPAC name is 3-[[(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]carbamoylamino]propyl-dipropylazanium.
| Compound Name | 3-[[(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]carbamoylamino]propyl-dipropylazanium |
|---|---|
| PubChem CID | 7552335 |
| Molecular Formula | C22H35N4O4+ |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 3-[[(3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]carbamoylamino]propyl-dipropylazanium |
| SMILES | CCC[NH+](CCC)CCCNC(=O)N[C@H]1CC(=O)N(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C22H34N4O4/c1-3-9-25(10-4-2)11-5-8-23-22(28)24-17-14-21(27)26(16-17)18-6-7-19-20(15-18)30-13-12-29-19/h6-7,15,17H,3-5,8-14,16H2,1-2H3,(H2,23,24,28)/p+1/t17-/m0/s1 |
| InChIKey | ICTUODBYMKQZSR-KRWDZBQOSA-O |
| XLogP | 0.96 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|