C19H27N3O5 — CID 7552153
1-[(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]-3-(3-propan-2-yloxypropyl)urea (PubChem CID 7552153) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]-3-(3-propan-2-yloxypropyl)urea.
| Compound Name | 1-[(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]-3-(3-propan-2-yloxypropyl)urea |
|---|---|
| PubChem CID | 7552153 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[(3R)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidin-3-yl]-3-(3-propan-2-yloxypropyl)urea |
| SMILES | CC(C)OCCCNC(=O)N[C@@H]1CC(=O)N(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C19H27N3O5/c1-13(2)25-7-3-6-20-19(24)21-14-10-18(23)22(12-14)15-4-5-16-17(11-15)27-9-8-26-16/h4-5,11,13-14H,3,6-10,12H2,1-2H3,(H2,20,21,24)/t14-/m1/s1 |
| InChIKey | SHRBDZRHICVBQU-CQSZACIVSA-N |
| XLogP | 1.68 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|