C22H36N4O2 — CID 43969662
1-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(dipropylamino)propyl]urea (PubChem CID 43969662) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(dipropylamino)propyl]urea.
| Compound Name | 1-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(dipropylamino)propyl]urea |
|---|---|
| PubChem CID | 43969662 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 1-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-3-[3-(dipropylamino)propyl]urea |
| SMILES | CCCN(CCC)CCCNC(=O)NC1CC(=O)N(c2ccc(C)c(C)c2)C1 |
| InChI | InChI=1S/C22H36N4O2/c1-5-11-25(12-6-2)13-7-10-23-22(28)24-19-15-21(27)26(16-19)20-9-8-17(3)18(4)14-20/h8-9,14,19H,5-7,10-13,15-16H2,1-4H3,(H2,23,24,28) |
| InChIKey | JHTZDSNNIGNAPJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|