C19H28N4O3 — CID 7543898
3-[(3R)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-1-methyl-1-(1-methylpiperidin-4-yl)urea (PubChem CID 7543898) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-[(3R)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-1-methyl-1-(1-methylpiperidin-4-yl)urea.
| Compound Name | 3-[(3R)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-1-methyl-1-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 7543898 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 3-[(3R)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-1-methyl-1-(1-methylpiperidin-4-yl)urea |
| SMILES | COc1cccc(N2C[C@H](NC(=O)N(C)C3CCN(C)CC3)CC2=O)c1 |
| InChI | InChI=1S/C19H28N4O3/c1-21-9-7-15(8-10-21)22(2)19(25)20-14-11-18(24)23(13-14)16-5-4-6-17(12-16)26-3/h4-6,12,14-15H,7-11,13H2,1-3H3,(H,20,25)/t14-/m1/s1 |
| InChIKey | JAIODANBVFHFQV-CQSZACIVSA-N |
| XLogP | 1.54 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |