C23H26N4O3 — CID 40506729
1-[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[2-(2-methylindol-1-yl)ethyl]urea (PubChem CID 40506729) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[2-(2-methylindol-1-yl)ethyl]urea.
| Compound Name | 1-[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[2-(2-methylindol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 40506729 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-[(3S)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[2-(2-methylindol-1-yl)ethyl]urea |
| SMILES | COc1cccc(N2C[C@@H](NC(=O)NCCn3c(C)cc4ccccc43)CC2=O)c1 |
| InChI | InChI=1S/C23H26N4O3/c1-16-12-17-6-3-4-9-21(17)26(16)11-10-24-23(29)25-18-13-22(28)27(15-18)19-7-5-8-20(14-19)30-2/h3-9,12,14,18H,10-11,13,15H2,1-2H3,(H2,24,25,29)/t18-/m0/s1 |
| InChIKey | JKEQAOPSHROEAE-SFHVURJKSA-N |
| XLogP | 3.06 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |