C24H31N5O3 — CID 16801428
1-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[2-(4-phenylpiperazin-1-yl)ethyl]urea (PubChem CID 16801428) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[2-(4-phenylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[2-(4-phenylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 16801428 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]-3-[2-(4-phenylpiperazin-1-yl)ethyl]urea |
| SMILES | COc1ccc(N2CC(NC(=O)NCCN3CCN(c4ccccc4)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C24H31N5O3/c1-32-22-9-7-21(8-10-22)29-18-19(17-23(29)30)26-24(31)25-11-12-27-13-15-28(16-14-27)20-5-3-2-4-6-20/h2-10,19H,11-18H2,1H3,(H2,25,26,31) |
| InChIKey | XXOPSEVGJCYSMY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |