C24H30ClN5O3 — CID 43970516
1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]urea (PubChem CID 43970516) has the molecular formula C24H30ClN5O3 and a molecular weight of 471.99 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]urea.
| Compound Name | 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 43970516 |
| Molecular Formula | C24H30ClN5O3 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]urea |
| SMILES | COc1ccc(N2CCN(CCNC(=O)NC3CC(=O)N(c4ccc(Cl)cc4)C3)CC2)cc1 |
| InChI | InChI=1S/C24H30ClN5O3/c1-33-22-8-6-20(7-9-22)29-14-12-28(13-15-29)11-10-26-24(32)27-19-16-23(31)30(17-19)21-4-2-18(25)3-5-21/h2-9,19H,10-17H2,1H3,(H2,26,27,32) |
| InChIKey | GXOBIAKKUUQLPI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|