C22H26N4O3 — CID 7490013
4-(4-methoxyphenyl)-N-[(3S)-5-oxo-1-phenylpyrrolidin-3-yl]piperazine-1-carboxamide (PubChem CID 7490013) has the molecular formula C22H26N4O3 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[(3S)-5-oxo-1-phenylpyrrolidin-3-yl]piperazine-1-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-N-[(3S)-5-oxo-1-phenylpyrrolidin-3-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 7490013 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[(3S)-5-oxo-1-phenylpyrrolidin-3-yl]piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)N[C@H]3CC(=O)N(c4ccccc4)C3)CC2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-29-20-9-7-18(8-10-20)24-11-13-25(14-12-24)22(28)23-17-15-21(27)26(16-17)19-5-3-2-4-6-19/h2-10,17H,11-16H2,1H3,(H,23,28)/t17-/m0/s1 |
| InChIKey | SGHJBTLRHNUMSW-KRWDZBQOSA-N |
| XLogP | 2.33 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|