C22H28N4O3 — CID 7545497
1-[2-[benzyl(methyl)amino]ethyl]-3-[(3R)-1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 7545497) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[2-[benzyl(methyl)amino]ethyl]-3-[(3R)-1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-[2-[benzyl(methyl)amino]ethyl]-3-[(3R)-1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 7545497 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[2-[benzyl(methyl)amino]ethyl]-3-[(3R)-1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | COc1ccc(N2C[C@H](NC(=O)NCCN(C)Cc3ccccc3)CC2=O)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-25(15-17-6-4-3-5-7-17)13-12-23-22(28)24-18-14-21(27)26(16-18)19-8-10-20(29-2)11-9-19/h3-11,18H,12-16H2,1-2H3,(H2,23,24,28)/t18-/m1/s1 |
| InChIKey | GABNQQVMKAASCB-GOSISDBHSA-N |
| XLogP | 2.23 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |