C18H21N5O4S — CID 46353639
2-N-(4-methoxyphenyl)-5-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,4-thiadiazole-2,5-dicarboxamide (PubChem CID 46353639) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-N-(4-methoxyphenyl)-5-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,4-thiadiazole-2,5-dicarboxamide.
| Compound Name | 2-N-(4-methoxyphenyl)-5-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,4-thiadiazole-2,5-dicarboxamide |
|---|---|
| PubChem CID | 46353639 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 2-N-(4-methoxyphenyl)-5-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,4-thiadiazole-2,5-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2nnc(C(=O)NCCCN3CCCC3=O)s2)cc1 |
| InChI | InChI=1S/C18H21N5O4S/c1-27-13-7-5-12(6-8-13)20-16(26)18-22-21-17(28-18)15(25)19-9-3-11-23-10-2-4-14(23)24/h5-8H,2-4,9-11H2,1H3,(H,19,25)(H,20,26) |
| InChIKey | GAQOIXUMODPOSS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|