C17H15BrN2O — CID 24678434
(E)-3-(2-bromophenyl)-1-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)prop-2-en-1-one (PubChem CID 24678434) has the molecular formula C17H15BrN2O and a molecular weight of 343.22 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-1-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-bromophenyl)-1-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24678434 |
| Molecular Formula | C17H15BrN2O |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (E)-3-(2-bromophenyl)-1-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Br)N1CCCc2ncccc21 |
| InChI | InChI=1S/C17H15BrN2O/c18-14-6-2-1-5-13(14)9-10-17(21)20-12-4-7-15-16(20)8-3-11-19-15/h1-3,5-6,8-11H,4,7,12H2/b10-9+ |
| InChIKey | VHERBRVVJQUGLE-MDZDMXLPSA-N |
| XLogP | 3.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|