C19H20N2O — CID 24678548
(E)-1-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one (PubChem CID 24678548) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24678548 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (E)-1-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCCc3ncccc32)c(C)c1 |
| InChI | InChI=1S/C19H20N2O/c1-14-7-8-16(15(2)13-14)9-10-19(22)21-12-4-5-17-18(21)6-3-11-20-17/h3,6-11,13H,4-5,12H2,1-2H3/b10-9+ |
| InChIKey | GNIJRQYDYHDGOU-MDZDMXLPSA-N |
| XLogP | 3.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|