C12H14BrNO2 — CID 86071563
1-[2-(2-bromophenyl)-2-hydroxyethyl]pyrrolidin-2-one (PubChem CID 86071563) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 1-[2-(2-bromophenyl)-2-hydroxyethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-(2-bromophenyl)-2-hydroxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 86071563 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 1-[2-(2-bromophenyl)-2-hydroxyethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CC(O)c1ccccc1Br |
| InChI | InChI=1S/C12H14BrNO2/c13-10-5-2-1-4-9(10)11(15)8-14-7-3-6-12(14)16/h1-2,4-5,11,15H,3,6-8H2 |
| InChIKey | YVJUSMZPUUCEGJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |