C13H26N2 — CID 20622591
3,9-diethyl-3,9-diazaspiro[5.5]undecane (PubChem CID 20622591) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 3,9-diethyl-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3,9-diethyl-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 20622591 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 3,9-diethyl-3,9-diazaspiro[5.5]undecane |
| SMILES | CCN1CCC2(CC1)CCN(CC)CC2 |
| InChI | InChI=1S/C13H26N2/c1-3-14-9-5-13(6-10-14)7-11-15(4-2)12-8-13/h3-12H2,1-2H3 |
| InChIKey | QCILEYVTGNQTRO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |