C14H28N2 — CID 147776127
8-tert-butyl-2-ethyl-2,8-diazaspiro[4.5]decane (PubChem CID 147776127) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 8-tert-butyl-2-ethyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-tert-butyl-2-ethyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 147776127 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 8-tert-butyl-2-ethyl-2,8-diazaspiro[4.5]decane |
| SMILES | CCN1CCC2(CCN(C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C14H28N2/c1-5-15-9-6-14(12-15)7-10-16(11-8-14)13(2,3)4/h5-12H2,1-4H3 |
| InChIKey | HGWGXHTYEKEPAL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |