C11H17NOS — CID 143838750
4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane (PubChem CID 143838750) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane.
| Compound Name | 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane |
|---|---|
| PubChem CID | 143838750 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane |
| SMILES | C=CC1=C(C=C)N(C)C(=O)SC1.CC |
| InChI | InChI=1S/C9H11NOS.C2H6/c1-4-7-6-12-9(11)10(3)8(7)5-2;1-2/h4-5H,1-2,6H2,3H3;1-2H3 |
| InChIKey | PMMFWSZDDBYKIL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|