About 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane
4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane (PubChem CID 143838750) has the molecular formula C11H17NOS
and a molecular weight of 211.33 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane.
Molecular Properties
| Compound Name | 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane |
| PubChem CID | 143838750 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane |
| SMILES | C=CC1=C(C=C)N(C)C(=O)SC1.CC |
| InChI | InChI=1S/C9H11NOS.C2H6/c1-4-7-6-12-9(11)10(3)8(7)5-2;1-2/h4-5H,1-2,6H2,3H3;1-2H3 |
| InChIKey | PMMFWSZDDBYKIL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane?
The IUPAC name of 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane (CID 143838750) is 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane.
What is the SMILES notation for 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane?
The canonical SMILES for 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane is C=CC1=C(C=C)N(C)C(=O)SC1.CC.
What is the InChIKey of 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane?
The InChIKey is PMMFWSZDDBYKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS.C2H6/c1-4-7-6-12-9(11)10(3)8(7)5-2;1-2/h4-5H,1-2,6H2,3H3;1-2H3.
What are the key properties of 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane?
4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane has a molecular weight of 211.33 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-3-methyl-6H-1,3-thiazin-2-one;ethane is sourced from PubChem (CID 143838750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).