C8H11NO — CID 91071913
3-ethenyl-1,4-dimethyl-2H-pyrrol-5-one (PubChem CID 91071913) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 3-ethenyl-1,4-dimethyl-2H-pyrrol-5-one.
| Compound Name | 3-ethenyl-1,4-dimethyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 91071913 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3-ethenyl-1,4-dimethyl-2H-pyrrol-5-one |
| SMILES | C=CC1=C(C)C(=O)N(C)C1 |
| InChI | InChI=1S/C8H11NO/c1-4-7-5-9(3)8(10)6(7)2/h4H,1,5H2,2-3H3 |
| InChIKey | HWBLEECCRMYWPS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |