About 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane
3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane (PubChem CID 160607365) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane.
Molecular Properties
| Compound Name | 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane |
| PubChem CID | 160607365 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane |
| SMILES | C.C.C=CC1=C(C)C(=O)CC1.CCC |
| InChI | InChI=1S/C8H10O.C3H8.2CH4/c1-3-7-4-5-8(9)6(7)2;1-3-2;;/h3H,1,4-5H2,2H3;3H2,1-2H3;2*1H4 |
| InChIKey | RFAZOVZJWREXHD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane?
The IUPAC name of 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane (CID 160607365) is 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane.
What is the SMILES notation for 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane?
The canonical SMILES for 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane is C.C.C=CC1=C(C)C(=O)CC1.CCC.
What is the InChIKey of 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane?
The InChIKey is RFAZOVZJWREXHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C3H8.2CH4/c1-3-7-4-5-8(9)6(7)2;1-3-2;;/h3H,1,4-5H2,2H3;3H2,1-2H3;2*1H4.
What are the key properties of 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane?
3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane has a molecular weight of 198.35 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2-methylcyclopent-2-en-1-one;methane;propane is sourced from PubChem (CID 160607365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).