C12H17NO — CID 172605623
(3E)-1-methyl-4-methylidene-3-(4-methylpent-1-en-3-ylidene)pyrrolidin-2-one (PubChem CID 172605623) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (3E)-1-methyl-4-methylidene-3-(4-methylpent-1-en-3-ylidene)pyrrolidin-2-one.
| Compound Name | (3E)-1-methyl-4-methylidene-3-(4-methylpent-1-en-3-ylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 172605623 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (3E)-1-methyl-4-methylidene-3-(4-methylpent-1-en-3-ylidene)pyrrolidin-2-one |
| SMILES | C=C/C(=C1\C(=C)CN(C)C1=O)C(C)C |
| InChI | InChI=1S/C12H17NO/c1-6-10(8(2)3)11-9(4)7-13(5)12(11)14/h6,8H,1,4,7H2,2-3,5H3/b11-10- |
| InChIKey | FJEHIRDAYDCVQH-KHPPLWFESA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|