C19H27FN2O4 — CID 163222646
2-[(3E,4E)-3-ethylidene-4-(4-methylpent-1-en-3-ylidene)-2,5-dioxopyrrolidin-1-yl]-N-methyl-5-oxopentanamide;fluoromethane (PubChem CID 163222646) has the molecular formula C19H27FN2O4 and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-[(3E,4E)-3-ethylidene-4-(4-methylpent-1-en-3-ylidene)-2,5-dioxopyrrolidin-1-yl]-N-methyl-5-oxopentanamide;fluoromethane.
| Compound Name | 2-[(3E,4E)-3-ethylidene-4-(4-methylpent-1-en-3-ylidene)-2,5-dioxopyrrolidin-1-yl]-N-methyl-5-oxopentanamide;fluoromethane |
|---|---|
| PubChem CID | 163222646 |
| Molecular Formula | C19H27FN2O4 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-[(3E,4E)-3-ethylidene-4-(4-methylpent-1-en-3-ylidene)-2,5-dioxopyrrolidin-1-yl]-N-methyl-5-oxopentanamide;fluoromethane |
| SMILES | C=C/C(=C1/C(=O)N(C(CCC=O)C(=O)NC)C(=O)/C1=C/C)C(C)C.CF |
| InChI | InChI=1S/C18H24N2O4.CH3F/c1-6-12(11(3)4)15-13(7-2)17(23)20(18(15)24)14(9-8-10-21)16(22)19-5;1-2/h6-7,10-11,14H,1,8-9H2,2-5H3,(H,19,22);1H3/b13-7+,15-12-; |
| InChIKey | RXBMEHQRGDLJQI-AWAYLOJGSA-N |
| XLogP | 2.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|