C20H35NO3 — CID 54676735
(3Z)-3-(1-hydroxy-13-methyltetradecylidene)-1-methylpyrrolidine-2,4-dione (PubChem CID 54676735) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is (3Z)-3-(1-hydroxy-13-methyltetradecylidene)-1-methylpyrrolidine-2,4-dione.
| Compound Name | (3Z)-3-(1-hydroxy-13-methyltetradecylidene)-1-methylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 54676735 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (3Z)-3-(1-hydroxy-13-methyltetradecylidene)-1-methylpyrrolidine-2,4-dione |
| SMILES | CC(C)CCCCCCCCCCC/C(O)=C1\C(=O)CN(C)C1=O |
| InChI | InChI=1S/C20H35NO3/c1-16(2)13-11-9-7-5-4-6-8-10-12-14-17(22)19-18(23)15-21(3)20(19)24/h16,22H,4-15H2,1-3H3/b19-17- |
| InChIKey | GTLBQPFVUCUYRU-ZPHPHTNESA-N |
| XLogP | 4.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|