C13H19NO — CID 145305760
(3E)-1-methyl-4-methylidene-3-[(Z)-2-propan-2-ylbut-2-enylidene]pyrrolidin-2-one (PubChem CID 145305760) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (3E)-1-methyl-4-methylidene-3-[(Z)-2-propan-2-ylbut-2-enylidene]pyrrolidin-2-one.
| Compound Name | (3E)-1-methyl-4-methylidene-3-[(Z)-2-propan-2-ylbut-2-enylidene]pyrrolidin-2-one |
|---|---|
| PubChem CID | 145305760 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (3E)-1-methyl-4-methylidene-3-[(Z)-2-propan-2-ylbut-2-enylidene]pyrrolidin-2-one |
| SMILES | C=C1CN(C)C(=O)/C1=C/C(=C\C)C(C)C |
| InChI | InChI=1S/C13H19NO/c1-6-11(9(2)3)7-12-10(4)8-14(5)13(12)15/h6-7,9H,4,8H2,1-3,5H3/b11-6+,12-7+ |
| InChIKey | BBCBIFQOCVMUAZ-GNXRPPCSSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|