C15H25NO — CID 143332418
ethane;1-[(3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]pyrrolidin-2-one (PubChem CID 143332418) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is ethane;1-[(3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]pyrrolidin-2-one.
| Compound Name | ethane;1-[(3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143332418 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | ethane;1-[(3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]pyrrolidin-2-one |
| SMILES | C=C/C=C\C(=C/C)C(C)N1CCCC1=O.CC |
| InChI | InChI=1S/C13H19NO.C2H6/c1-4-6-8-12(5-2)11(3)14-10-7-9-13(14)15;1-2/h4-6,8,11H,1,7,9-10H2,2-3H3;1-2H3/b8-6-,12-5+; |
| InChIKey | JSOAFQYFFOWSGW-PZSOITJBSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|