C10H16N2O2 — CID 147026629
(Z)-N-[1-(2-oxopyrrolidin-1-yl)ethyl]but-2-enamide (PubChem CID 147026629) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (Z)-N-[1-(2-oxopyrrolidin-1-yl)ethyl]but-2-enamide.
| Compound Name | (Z)-N-[1-(2-oxopyrrolidin-1-yl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 147026629 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (Z)-N-[1-(2-oxopyrrolidin-1-yl)ethyl]but-2-enamide |
| SMILES | C/C=C\C(=O)NC(C)N1CCCC1=O |
| InChI | InChI=1S/C10H16N2O2/c1-3-5-9(13)11-8(2)12-7-4-6-10(12)14/h3,5,8H,4,6-7H2,1-2H3,(H,11,13)/b5-3- |
| InChIKey | AWUCLXCQBLFOTJ-HYXAFXHYSA-N |
| XLogP | 0.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|