C14H21NO2 — CID 143373088
1-[(3E,5Z)-3-ethenyl-1-methoxyhepta-3,5-dien-2-yl]pyrrolidin-2-one (PubChem CID 143373088) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[(3E,5Z)-3-ethenyl-1-methoxyhepta-3,5-dien-2-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3E,5Z)-3-ethenyl-1-methoxyhepta-3,5-dien-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143373088 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-[(3E,5Z)-3-ethenyl-1-methoxyhepta-3,5-dien-2-yl]pyrrolidin-2-one |
| SMILES | C=C/C(=C\C=C/C)C(COC)N1CCCC1=O |
| InChI | InChI=1S/C14H21NO2/c1-4-6-8-12(5-2)13(11-17-3)15-10-7-9-14(15)16/h4-6,8,13H,2,7,9-11H2,1,3H3/b6-4-,12-8+ |
| InChIKey | JICFCMFVWRSYQT-XWBYBSRJSA-N |
| XLogP | 2.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|